C20H26ClN3O3S — CID 55361761
2-[(2-chlorophenyl)methyl-methylamino]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 55361761) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55361761 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)C(C)N(C)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H26ClN3O3S/c1-14(2)23-28(26,27)18-11-9-17(10-12-18)22-20(25)15(3)24(4)13-16-7-5-6-8-19(16)21/h5-12,14-15,23H,13H2,1-4H3,(H,22,25) |
| InChIKey | SSKMYUGWJZTERX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |