About N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide
N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 55362818) has the molecular formula C20H21N3O3S2
and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide |
| PubChem CID | 55362818 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCC(=O)N(CC1CCCO1)c1nc2ccccc2s1)c1cccs1 |
| InChI | InChI=1S/C20H21N3O3S2/c24-18(9-10-21-19(25)17-8-4-12-27-17)23(13-14-5-3-11-26-14)20-22-15-6-1-2-7-16(15)28-20/h1-2,4,6-8,12,14H,3,5,9-11,13H2,(H,21,25) |
| InChIKey | IKAKBDGVKHCENH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide?
The IUPAC name of N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide (CID 55362818) is N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide?
The canonical SMILES for N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide is O=C(NCCC(=O)N(CC1CCCO1)c1nc2ccccc2s1)c1cccs1.
What is the InChIKey of N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide?
The InChIKey is IKAKBDGVKHCENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O3S2/c24-18(9-10-21-19(25)17-8-4-12-27-17)23(13-14-5-3-11-26-14)20-22-15-6-1-2-7-16(15)28-20/h1-2,4,6-8,12,14H,3,5,9-11,13H2,(H,21,25).
What are the key properties of N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide?
N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide has a molecular weight of 415.54 g/mol, XLogP of 3.69, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[1,3-benzothiazol-2-yl(oxolan-2-ylmethyl)amino]-3-oxopropyl]thiophene-2-carboxamide is sourced from PubChem (CID 55362818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).