C21H22N4O7S — CID 55363165
N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 55363165) has the molecular formula C21H22N4O7S and a molecular weight of 474.50 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 55363165 |
| Molecular Formula | C21H22N4O7S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H22N4O7S/c26-20(14-24-18-9-8-16(25(28)29)13-19(18)32-21(24)27)22-15-6-5-7-17(12-15)33(30,31)23-10-3-1-2-4-11-23/h5-9,12-13H,1-4,10-11,14H2,(H,22,26) |
| InChIKey | GHAQRLWZKWDIII-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|