C18H14BrFN2O3S — CID 55364108
(4-bromo-2-fluorophenyl) 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate (PubChem CID 55364108) has the molecular formula C18H14BrFN2O3S and a molecular weight of 437.29 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate.
| Compound Name | (4-bromo-2-fluorophenyl) 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55364108 |
| Molecular Formula | C18H14BrFN2O3S |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate |
| SMILES | Cc1noc(C)c1CSc1ncccc1C(=O)Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H14BrFN2O3S/c1-10-14(11(2)25-22-10)9-26-17-13(4-3-7-21-17)18(23)24-16-6-5-12(19)8-15(16)20/h3-8H,9H2,1-2H3 |
| InChIKey | RYHFMJJRPCEOJD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|