C22H23ClN2O6 — CID 55364962
[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 55364962) has the molecular formula C22H23ClN2O6 and a molecular weight of 446.89 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 55364962 |
| Molecular Formula | C22H23ClN2O6 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | COc1ccc(-c2noc(COC(=O)CCCOc3ccc(Cl)cc3C)n2)cc1OC |
| InChI | InChI=1S/C22H23ClN2O6/c1-14-11-16(23)7-9-17(14)29-10-4-5-21(26)30-13-20-24-22(25-31-20)15-6-8-18(27-2)19(12-15)28-3/h6-9,11-12H,4-5,10,13H2,1-3H3 |
| InChIKey | LTSJDIBOVQHQKE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|