About [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate (PubChem CID 55367090) has the molecular formula C20H27N3O3
and a molecular weight of 357.45 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate.
Molecular Properties
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate |
| PubChem CID | 55367090 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate |
| SMILES | CC(C)CN(CC(C)C)C(=O)COC(=O)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-15(2)12-22(13-16(3)4)19(24)14-26-20(25)17-6-8-18(9-7-17)23-11-5-10-21-23/h5-11,15-16H,12-14H2,1-4H3 |
| InChIKey | LLPHHQFFOSIPCZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate?
The IUPAC name of [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate (CID 55367090) is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate.
What is the SMILES notation for [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate?
The canonical SMILES for [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate is CC(C)CN(CC(C)C)C(=O)COC(=O)c1ccc(-n2cccn2)cc1.
What is the InChIKey of [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate?
The InChIKey is LLPHHQFFOSIPCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O3/c1-15(2)12-22(13-16(3)4)19(24)14-26-20(25)17-6-8-18(9-7-17)23-11-5-10-21-23/h5-11,15-16H,12-14H2,1-4H3.
What are the key properties of [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate?
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate has a molecular weight of 357.45 g/mol, XLogP of 3.17, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 4-pyrazol-1-ylbenzoate is sourced from PubChem (CID 55367090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).