C28H33N5O3 — CID 55368383
2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 55368383) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55368383 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | COc1ccccc1C1C(C(=O)NCc2nnc3n2CCCCC3)CCC(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C28H33N5O3/c1-19-11-13-20(14-12-19)33-26(34)16-15-22(27(33)21-8-5-6-9-23(21)36-2)28(35)29-18-25-31-30-24-10-4-3-7-17-32(24)25/h5-6,8-9,11-14,22,27H,3-4,7,10,15-18H2,1-2H3,(H,29,35) |
| InChIKey | NPLKBZIDMBRXGA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |