C25H20F2N2O4 — CID 55368512
N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55368512) has the molecular formula C25H20F2N2O4 and a molecular weight of 450.44 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55368512 |
| Molecular Formula | C25H20F2N2O4 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)NCc4ccc(OC(F)F)cc4)cc3C2=O)c1 |
| InChI | InChI=1S/C25H20F2N2O4/c1-14-3-4-15(2)21(11-14)29-23(31)19-10-7-17(12-20(19)24(29)32)22(30)28-13-16-5-8-18(9-6-16)33-25(26)27/h3-12,25H,13H2,1-2H3,(H,28,30) |
| InChIKey | MRLATCJSDWNUDA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|