C21H26IN3O2 — CID 55369421
N-[2-[[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-2-iodobenzamide (PubChem CID 55369421) has the molecular formula C21H26IN3O2 and a molecular weight of 479.36 g/mol. Its IUPAC name is N-[2-[[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-2-iodobenzamide.
| Compound Name | N-[2-[[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 55369421 |
| Molecular Formula | C21H26IN3O2 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[2-[[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-2-iodobenzamide |
| SMILES | CCc1ccc(C(CNC(=O)CNC(=O)c2ccccc2I)N(C)C)cc1 |
| InChI | InChI=1S/C21H26IN3O2/c1-4-15-9-11-16(12-10-15)19(25(2)3)13-23-20(26)14-24-21(27)17-7-5-6-8-18(17)22/h5-12,19H,4,13-14H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | VZKHONOTSFHQLW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|