C22H21ClF3N3O3S — CID 55371704
N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide (PubChem CID 55371704) has the molecular formula C22H21ClF3N3O3S and a molecular weight of 499.94 g/mol. Its IUPAC name is N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide.
| Compound Name | N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55371704 |
| Molecular Formula | C22H21ClF3N3O3S |
| Molecular Weight | 499.94 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)Nc1ncc(Cc2cc(C(F)(F)F)ccc2Cl)s1 |
| InChI | InChI=1S/C22H21ClF3N3O3S/c23-17-6-5-13(22(24,25)26)9-12(17)10-14-11-27-21(33-14)28-18(30)7-8-29-19(31)15-3-1-2-4-16(15)20(29)32/h5-6,9,11,15-16H,1-4,7-8,10H2,(H,27,28,30) |
| InChIKey | VSTKRZMISFBCQX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|