C13H10Cl3NO3 — CID 55374507
(2,4,6-trichlorophenyl) 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 55374507) has the molecular formula C13H10Cl3NO3 and a molecular weight of 334.59 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | (2,4,6-trichlorophenyl) 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 55374507 |
| Molecular Formula | C13H10Cl3NO3 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | (2,4,6-trichlorophenyl) 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCc1noc(C)c1C(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO3/c1-3-10-11(6(2)20-17-10)13(18)19-12-8(15)4-7(14)5-9(12)16/h4-5H,3H2,1-2H3 |
| InChIKey | VQKVURTYDHGVOY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|