C24H24N2O5 — CID 55375282
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55375282) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55375282 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)OCC(=O)NC1CCCc3ccccc31)C2=O |
| InChI | InChI=1S/C24H24N2O5/c1-15-9-10-18-19(13-15)24(30)26(23(18)29)12-11-22(28)31-14-21(27)25-20-8-4-6-16-5-2-3-7-17(16)20/h2-3,5,7,9-10,13,20H,4,6,8,11-12,14H2,1H3,(H,25,27) |
| InChIKey | MYEWLDSCJGCXMU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|