About (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate
(5-methyl-2-oxooxolan-3-yl) 2-phenylacetate (PubChem CID 55377308) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate.
Molecular Properties
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate |
| PubChem CID | 55377308 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate |
| SMILES | CC1CC(OC(=O)Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C13H14O4/c1-9-7-11(13(15)16-9)17-12(14)8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | OXNCOMTTXXNWGB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate?
The IUPAC name of (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate (CID 55377308) is (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate.
What is the SMILES notation for (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate?
The canonical SMILES for (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate is CC1CC(OC(=O)Cc2ccccc2)C(=O)O1.
What is the InChIKey of (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate?
The InChIKey is OXNCOMTTXXNWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4/c1-9-7-11(13(15)16-9)17-12(14)8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3.
What are the key properties of (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate?
(5-methyl-2-oxooxolan-3-yl) 2-phenylacetate has a molecular weight of 234.25 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-oxooxolan-3-yl) 2-phenylacetate is sourced from PubChem (CID 55377308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).