C17H11Cl2F2N3O — CID 55377836
2-chloro-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4,5-difluorobenzamide (PubChem CID 55377836) has the molecular formula C17H11Cl2F2N3O and a molecular weight of 382.20 g/mol. Its IUPAC name is 2-chloro-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 55377836 |
| Molecular Formula | C17H11Cl2F2N3O |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-chloro-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4,5-difluorobenzamide |
| SMILES | Cc1cc(NC(=O)c2cc(F)c(F)cc2Cl)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H11Cl2F2N3O/c1-9-5-16(24(23-9)11-4-2-3-10(18)6-11)22-17(25)12-7-14(20)15(21)8-13(12)19/h2-8H,1H3,(H,22,25) |
| InChIKey | JOWACHTVDOJMMA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|