C22H18N4O6S — CID 55378631
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate (PubChem CID 55378631) has the molecular formula C22H18N4O6S and a molecular weight of 466.48 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
|---|---|
| PubChem CID | 55378631 |
| Molecular Formula | C22H18N4O6S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)sc2nc3n(c(=O)c12)CCC3 |
| InChI | InChI=1S/C22H18N4O6S/c1-10-16-18(24-14-4-3-7-26(14)21(16)30)33-17(10)22(31)32-9-15(27)23-11-5-6-12-13(8-11)20(29)25(2)19(12)28/h5-6,8H,3-4,7,9H2,1-2H3,(H,23,27) |
| InChIKey | YSUAUKURVKXHAA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|