About (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate
(5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 55378748) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate.
Molecular Properties
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| PubChem CID | 55378748 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)OC2CC(C)OC2=O)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-11-4-5-12(2)19(11)15-8-6-14(7-9-15)17(20)23-16-10-13(3)22-18(16)21/h4-9,13,16H,10H2,1-3H3 |
| InChIKey | WYCBCQCYVDSPRE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate?
The IUPAC name of (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate (CID 55378748) is (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate.
What is the SMILES notation for (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate?
The canonical SMILES for (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate is Cc1ccc(C)n1-c1ccc(C(=O)OC2CC(C)OC2=O)cc1.
What is the InChIKey of (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate?
The InChIKey is WYCBCQCYVDSPRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c1-11-4-5-12(2)19(11)15-8-6-14(7-9-15)17(20)23-16-10-13(3)22-18(16)21/h4-9,13,16H,10H2,1-3H3.
What are the key properties of (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate?
(5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate has a molecular weight of 313.35 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-oxooxolan-3-yl) 4-(2,5-dimethylpyrrol-1-yl)benzoate is sourced from PubChem (CID 55378748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).