About [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate (PubChem CID 55378755) has the molecular formula C21H28N2O3
and a molecular weight of 356.47 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate.
Molecular Properties
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate |
| PubChem CID | 55378755 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate |
| SMILES | CCN(C(=O)COC(=O)CCn1ccc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C21H28N2O3/c1-2-23(18-9-4-3-5-10-18)20(24)16-26-21(25)13-15-22-14-12-17-8-6-7-11-19(17)22/h6-8,11-12,14,18H,2-5,9-10,13,15-16H2,1H3 |
| InChIKey | KARQLSAUSNBDCJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate?
The IUPAC name of [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate (CID 55378755) is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate.
What is the SMILES notation for [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate?
The canonical SMILES for [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate is CCN(C(=O)COC(=O)CCn1ccc2ccccc21)C1CCCCC1.
What is the InChIKey of [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate?
The InChIKey is KARQLSAUSNBDCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O3/c1-2-23(18-9-4-3-5-10-18)20(24)16-26-21(25)13-15-22-14-12-17-8-6-7-11-19(17)22/h6-8,11-12,14,18H,2-5,9-10,13,15-16H2,1H3.
What are the key properties of [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate?
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate has a molecular weight of 356.47 g/mol, XLogP of 3.76, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-indol-1-ylpropanoate is sourced from PubChem (CID 55378755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).