C21H21N3O2S2 — CID 55379180
11-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 55379180) has the molecular formula C21H21N3O2S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 11-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 11-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 55379180 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 11-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | CC1CCN(C(=O)Cn2cnc3sc4c(c3c2=O)CCC4)c2ccccc2S1 |
| InChI | InChI=1S/C21H21N3O2S2/c1-13-9-10-24(15-6-2-3-7-17(15)27-13)18(25)11-23-12-22-20-19(21(23)26)14-5-4-8-16(14)28-20/h2-3,6-7,12-13H,4-5,8-11H2,1H3 |
| InChIKey | GUOFXVOLDIFEEC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |