C15H36O6Si4 — CID 553797
bis(trimethylsilyl) 2,2-bis(trimethylsilyloxy)propanedioate (PubChem CID 553797) has the molecular formula C15H36O6Si4 and a molecular weight of 424.79 g/mol. Its IUPAC name is bis(trimethylsilyl) 2,2-bis(trimethylsilyloxy)propanedioate.
| Compound Name | bis(trimethylsilyl) 2,2-bis(trimethylsilyloxy)propanedioate |
|---|---|
| PubChem CID | 553797 |
| Molecular Formula | C15H36O6Si4 |
| Molecular Weight | 424.79 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | bis(trimethylsilyl) 2,2-bis(trimethylsilyloxy)propanedioate |
| SMILES | C[Si](C)(C)OC(=O)C(O[Si](C)(C)C)(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H36O6Si4/c1-22(2,3)18-13(16)15(20-24(7,8)9,21-25(10,11)12)14(17)19-23(4,5)6/h1-12H3 |
| InChIKey | KHVUOWWPNVBADO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|