C21H18F3N3O6 — CID 55379806
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 55379806) has the molecular formula C21H18F3N3O6 and a molecular weight of 465.38 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 55379806 |
| Molecular Formula | C21H18F3N3O6 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | CC(OC(=O)CCn1c(=O)oc2ccccc21)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H18F3N3O6/c1-11(20(30)25-10-16(28)26-13-7-6-12(22)18(23)19(13)24)32-17(29)8-9-27-14-4-2-3-5-15(14)33-21(27)31/h2-7,11H,8-10H2,1H3,(H,25,30)(H,26,28) |
| InChIKey | WTVRAZYVAWMRPQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|