C20H19N3O8 — CID 55379956
[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 55379956) has the molecular formula C20H19N3O8 and a molecular weight of 429.39 g/mol. Its IUPAC name is [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 55379956 |
| Molecular Formula | C20H19N3O8 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)OC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C20H19N3O8/c1-12(19(25)21-14-11-13(23(27)28)7-8-16(14)29-2)30-18(24)9-10-22-15-5-3-4-6-17(15)31-20(22)26/h3-8,11-12H,9-10H2,1-2H3,(H,21,25) |
| InChIKey | LIOCGYDKIFDFEI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|