C20H23N3O5 — CID 55380062
[2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] pent-2-enoate (PubChem CID 55380062) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is [2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] pent-2-enoate.
| Compound Name | [2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] pent-2-enoate |
|---|---|
| PubChem CID | 55380062 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] pent-2-enoate |
| SMILES | CCC=CC(=O)OCC(=O)c1c(N)n(Cc2ccccc2)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C20H23N3O5/c1-3-5-11-16(25)28-13-15(24)17-18(21)23(12-14-9-7-6-8-10-14)20(27)22(4-2)19(17)26/h5-11H,3-4,12-13,21H2,1-2H3 |
| InChIKey | BTNRRDKJWFBMLS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|