C21H19N3O3S2 — CID 55380922
N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide (PubChem CID 55380922) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55380922 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3cc4c(cc3s2)OCCO4)c(C)n1Cc1cccs1 |
| InChI | InChI=1S/C21H19N3O3S2/c1-12-8-15(13(2)24(12)11-14-4-3-7-28-14)20(25)23-21-22-16-9-17-18(10-19(16)29-21)27-6-5-26-17/h3-4,7-10H,5-6,11H2,1-2H3,(H,22,23,25) |
| InChIKey | DYVORNRIMCKLTQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |