C20H20N4O5 — CID 55385525
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)propanoate (PubChem CID 55385525) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)propanoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)propanoate |
|---|---|
| PubChem CID | 55385525 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)propanoate |
| SMILES | Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)OCC(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N4O5/c1-12-15(13(2)22-20(28)16(12)10-21)8-9-18(26)29-11-17(25)23-24-19(27)14-6-4-3-5-7-14/h3-7H,8-9,11H2,1-2H3,(H,22,28)(H,23,25)(H,24,27) |
| InChIKey | COLOUYSTWUSLAJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 141.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|