C21H23N3O8S — CID 55385615
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 55385615) has the molecular formula C21H23N3O8S and a molecular weight of 477.50 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 55385615 |
| Molecular Formula | C21H23N3O8S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)c2ccc3c(c2)CCN3S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C21H23N3O8S/c1-30-17-7-5-14(11-18(17)31-2)20(26)23-22-19(25)12-32-21(27)15-4-6-16-13(10-15)8-9-24(16)33(3,28)29/h4-7,10-11H,8-9,12H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | DJAVQISNXIZBAD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|