About (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate
(2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate (PubChem CID 55386516) has the molecular formula C11H6Cl3NO3
and a molecular weight of 306.53 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate |
| PubChem CID | 55386516 |
| Molecular Formula | C11H6Cl3NO3 |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate |
| SMILES | Cc1cc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)on1 |
| InChI | InChI=1S/C11H6Cl3NO3/c1-5-2-9(18-15-5)11(16)17-10-7(13)3-6(12)4-8(10)14/h2-4H,1H3 |
| InChIKey | BLDKHDXFFIAXQC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate?
The IUPAC name of (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate (CID 55386516) is (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate.
What is the SMILES notation for (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate?
The canonical SMILES for (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate is Cc1cc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)on1.
What is the InChIKey of (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate?
The InChIKey is BLDKHDXFFIAXQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl3NO3/c1-5-2-9(18-15-5)11(16)17-10-7(13)3-6(12)4-8(10)14/h2-4H,1H3.
What are the key properties of (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate?
(2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate has a molecular weight of 306.53 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trichlorophenyl) 3-methyl-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 55386516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).