C17H14Cl3FN2O2 — CID 55386691
2,4-dichloro-N-(5-chloro-2-morpholin-4-ylphenyl)-5-fluorobenzamide (PubChem CID 55386691) has the molecular formula C17H14Cl3FN2O2 and a molecular weight of 403.67 g/mol. Its IUPAC name is 2,4-dichloro-N-(5-chloro-2-morpholin-4-ylphenyl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(5-chloro-2-morpholin-4-ylphenyl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 55386691 |
| Molecular Formula | C17H14Cl3FN2O2 |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2,4-dichloro-N-(5-chloro-2-morpholin-4-ylphenyl)-5-fluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCOCC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl3FN2O2/c18-10-1-2-16(23-3-5-25-6-4-23)15(7-10)22-17(24)11-8-14(21)13(20)9-12(11)19/h1-2,7-9H,3-6H2,(H,22,24) |
| InChIKey | IBPFSZARPYCTPW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|