C24H36N4O5S — CID 55387567
2-[[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55387567) has the molecular formula C24H36N4O5S and a molecular weight of 492.64 g/mol. Its IUPAC name is 2-[[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55387567 |
| Molecular Formula | C24H36N4O5S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 2-[[2-[cyclopentyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)CC(=O)N(C1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H36N4O5S/c1-26(16-23(29)25-19-6-8-20(9-7-19)27-11-13-33-14-12-27)17-24(30)28(21-4-2-3-5-21)22-10-15-34(31,32)18-22/h6-9,21-22H,2-5,10-18H2,1H3,(H,25,29) |
| InChIKey | HVNIKMBHUBILIL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|