C24H29N3O2 — CID 55387870
4-tert-butyl-N-[1-[4-(cyanomethyl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 55387870) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[4-(cyanomethyl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[4-(cyanomethyl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55387870 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 4-tert-butyl-N-[1-[4-(cyanomethyl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-16(2)21(23(29)26-20-12-6-17(7-13-20)14-15-25)27-22(28)18-8-10-19(11-9-18)24(3,4)5/h6-13,16,21H,14H2,1-5H3,(H,26,29)(H,27,28) |
| InChIKey | XHTCQERVPCVMKR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |