C25H30N2O5 — CID 55390523
[2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 55390523) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55390523 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)OC(C(=O)NC2CC2)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O5/c1-4-31-20-14-10-18(11-15-20)23(28)27-21(16(2)3)25(30)32-22(17-8-6-5-7-9-17)24(29)26-19-12-13-19/h5-11,14-16,19,21-22H,4,12-13H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | YTGQHTBMUGBDCC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |