C23H19N5O4S — CID 55390580
4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 55390580) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is 4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | 4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 55390580 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CSc2nnc(C3COc4ccccc4O3)o2)N(C)c2ccccc21 |
| InChI | InChI=1S/C23H19N5O4S/c1-27-15-7-3-4-8-16(15)28(2)22(27)14(11-24)17(29)13-33-23-26-25-21(32-23)20-12-30-18-9-5-6-10-19(18)31-20/h3-10,20H,12-13H2,1-2H3 |
| InChIKey | BJWQSONSPCYWDZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 104.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|