C23H20N4O2 — CID 55390619
2-(4-methyl-1-oxophthalazin-2-yl)-N',N'-diphenylacetohydrazide (PubChem CID 55390619) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-(4-methyl-1-oxophthalazin-2-yl)-N',N'-diphenylacetohydrazide.
| Compound Name | 2-(4-methyl-1-oxophthalazin-2-yl)-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 55390619 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-(4-methyl-1-oxophthalazin-2-yl)-N',N'-diphenylacetohydrazide |
| SMILES | Cc1nn(CC(=O)NN(c2ccccc2)c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H20N4O2/c1-17-20-14-8-9-15-21(20)23(29)26(24-17)16-22(28)25-27(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15H,16H2,1H3,(H,25,28) |
| InChIKey | CNDNPRWJKZXDCO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|