C23H20Cl2N4O3 — CID 55391273
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]propanamide (PubChem CID 55391273) has the molecular formula C23H20Cl2N4O3 and a molecular weight of 471.34 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]propanamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 55391273 |
| Molecular Formula | C23H20Cl2N4O3 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]propanamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)C(C)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C23H20Cl2N4O3/c1-12-18(13(2)29(27-12)15-7-5-4-6-8-15)11-26-21(30)14(3)28-22(31)16-9-19(24)20(25)10-17(16)23(28)32/h4-10,14H,11H2,1-3H3,(H,26,30) |
| InChIKey | XLZQBYJEPRIMLJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|