C22H27N3O5 — CID 55392409
[2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55392409) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55392409 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CCCCC12NC(=O)N(CC(=O)OC(C(=O)NC1CC1)c1ccccc1)C2=O |
| InChI | InChI=1S/C22H27N3O5/c1-14-7-5-6-12-22(14)20(28)25(21(29)24-22)13-17(26)30-18(15-8-3-2-4-9-15)19(27)23-16-10-11-16/h2-4,8-9,14,16,18H,5-7,10-13H2,1H3,(H,23,27)(H,24,29) |
| InChIKey | YMADQRKOCRUFGC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|