C12H15F6NO5Si — CID 553925
trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate (PubChem CID 553925) has the molecular formula C12H15F6NO5Si and a molecular weight of 395.33 g/mol. Its IUPAC name is trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate.
| Compound Name | trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 553925 |
| Molecular Formula | C12H15F6NO5Si |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-(2,2,2-trifluoroacetyl)oxypyrrolidine-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1CC(OC(=O)C(F)(F)F)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F6NO5Si/c1-25(2,3)24-8(20)7-4-6(23-10(22)12(16,17)18)5-19(7)9(21)11(13,14)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | PYCYPPPMVDFVGV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|