C24H32N4O7 — CID 55393783
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3,4,5-triethoxybenzoate (PubChem CID 55393783) has the molecular formula C24H32N4O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3,4,5-triethoxybenzoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 55393783 |
| Molecular Formula | C24H32N4O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3,4,5-triethoxybenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cc(OCC)c(OCC)c(OCC)c1)n2C |
| InChI | InChI=1S/C24H32N4O7/c1-6-10-11-28-21-19(22(29)26-24(28)31)27(5)18(25-21)14-35-23(30)15-12-16(32-7-2)20(34-9-4)17(13-15)33-8-3/h12-13H,6-11,14H2,1-5H3,(H,26,29,31) |
| InChIKey | DTJBVBBQKMUDKY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |