C17H22N2O5S — CID 55394465
N-(1,1-dioxothiolan-3-yl)-5-methoxy-N',N',3-trimethyl-1-benzofuran-2-carbohydrazide (PubChem CID 55394465) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-methoxy-N',N',3-trimethyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-methoxy-N',N',3-trimethyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 55394465 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-methoxy-N',N',3-trimethyl-1-benzofuran-2-carbohydrazide |
| SMILES | COc1ccc2oc(C(=O)N(C3CCS(=O)(=O)C3)N(C)C)c(C)c2c1 |
| InChI | InChI=1S/C17H22N2O5S/c1-11-14-9-13(23-4)5-6-15(14)24-16(11)17(20)19(18(2)3)12-7-8-25(21,22)10-12/h5-6,9,12H,7-8,10H2,1-4H3 |
| InChIKey | SFNZWIZTGHKGAQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|