C22H21ClN4O4 — CID 55396902
methyl 2-[[4-[(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)amino]benzoyl]amino]acetate (PubChem CID 55396902) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is methyl 2-[[4-[(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55396902 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl 2-[[4-[(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)c2c(C)nn(Cc3ccccc3)c2Cl)cc1 |
| InChI | InChI=1S/C22H21ClN4O4/c1-14-19(20(23)27(26-14)13-15-6-4-3-5-7-15)22(30)25-17-10-8-16(9-11-17)21(29)24-12-18(28)31-2/h3-11H,12-13H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | YNHOECLXAGCXFT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |