C22H28N2O8 — CID 55398022
[2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 55398022) has the molecular formula C22H28N2O8 and a molecular weight of 448.47 g/mol. Its IUPAC name is [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55398022 |
| Molecular Formula | C22H28N2O8 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)COC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C22H28N2O8/c1-29-16-9-18(31-3)17(30-2)8-13(16)10-23-19(25)12-32-20(26)11-24-21(27)14-6-4-5-7-15(14)22(24)28/h8-9,14-15H,4-7,10-12H2,1-3H3,(H,23,25) |
| InChIKey | FKJNAXVEMJUKJY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|