C24H26FN5O4 — CID 55398855
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 55398855) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55398855 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cc(C)n(-c3ccc(F)cc3)c1C)n2C |
| InChI | InChI=1S/C24H26FN5O4/c1-5-6-11-29-21-20(22(31)27-24(29)33)28(4)19(26-21)13-34-23(32)18-12-14(2)30(15(18)3)17-9-7-16(25)8-10-17/h7-10,12H,5-6,11,13H2,1-4H3,(H,27,31,33) |
| InChIKey | BIZVCILHMFZNBK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|