C23H25NO7 — CID 55399756
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 5-methoxy-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 55399756) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 5-methoxy-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 55399756 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOc1ccc(OCCNC(=O)COC(=O)c2oc3ccc(OC)cc3c2C)cc1 |
| InChI | InChI=1S/C23H25NO7/c1-4-28-16-5-7-17(8-6-16)29-12-11-24-21(25)14-30-23(26)22-15(2)19-13-18(27-3)9-10-20(19)31-22/h5-10,13H,4,11-12,14H2,1-3H3,(H,24,25) |
| InChIKey | HSMPSQXVZAEBOB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|