C18H32N4OS — CID 55400077
2-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-heptan-2-ylacetamide (PubChem CID 55400077) has the molecular formula C18H32N4OS and a molecular weight of 352.55 g/mol. Its IUPAC name is 2-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-heptan-2-ylacetamide.
| Compound Name | 2-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-heptan-2-ylacetamide |
|---|---|
| PubChem CID | 55400077 |
| Molecular Formula | C18H32N4OS |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-[(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-heptan-2-ylacetamide |
| SMILES | CCCCCC(C)NC(=O)CSc1nnc(C)n1C1CCCCC1 |
| InChI | InChI=1S/C18H32N4OS/c1-4-5-7-10-14(2)19-17(23)13-24-18-21-20-15(3)22(18)16-11-8-6-9-12-16/h14,16H,4-13H2,1-3H3,(H,19,23) |
| InChIKey | SPWBTFPLSJUCJV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|