C20H23ClN4O6 — CID 55400627
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-chloro-4,5-dimethoxybenzoate (PubChem CID 55400627) has the molecular formula C20H23ClN4O6 and a molecular weight of 450.88 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 55400627 |
| Molecular Formula | C20H23ClN4O6 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cc(Cl)c(OC)c(OC)c1)n2C |
| InChI | InChI=1S/C20H23ClN4O6/c1-5-6-7-25-17-15(18(26)23-20(25)28)24(2)14(22-17)10-31-19(27)11-8-12(21)16(30-4)13(9-11)29-3/h8-9H,5-7,10H2,1-4H3,(H,23,26,28) |
| InChIKey | CVYUWQOGAICCOF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |