About (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate
(1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate (PubChem CID 55400770) has the molecular formula C15H20N4O3S
and a molecular weight of 336.42 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate.
Molecular Properties
| Compound Name | (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
| PubChem CID | 55400770 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
| SMILES | CCCn1nnnc1COC(=O)CCC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C15H20N4O3S/c1-4-7-19-14(16-17-18-19)9-22-15(21)6-5-13(20)12-8-10(2)23-11(12)3/h8H,4-7,9H2,1-3H3 |
| InChIKey | GGANZAMOIYUVKT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
The IUPAC name of (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate (CID 55400770) is (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate.
What is the SMILES notation for (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
The canonical SMILES for (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate is CCCn1nnnc1COC(=O)CCC(=O)c1cc(C)sc1C.
What is the InChIKey of (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
The InChIKey is GGANZAMOIYUVKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O3S/c1-4-7-19-14(16-17-18-19)9-22-15(21)6-5-13(20)12-8-10(2)23-11(12)3/h8H,4-7,9H2,1-3H3.
What are the key properties of (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
(1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate has a molecular weight of 336.42 g/mol, XLogP of 2.47, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propyltetrazol-5-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate is sourced from PubChem (CID 55400770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).