About (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate (PubChem CID 55402431) has the molecular formula C23H28ClN5O5
and a molecular weight of 489.96 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate.
Molecular Properties
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate |
| PubChem CID | 55402431 |
| Molecular Formula | C23H28ClN5O5 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)CC(NC(C)=O)c1ccc(Cl)cc1)n2CC |
| InChI | InChI=1S/C23H28ClN5O5/c1-4-6-11-29-21-20(22(32)27-23(29)33)28(5-2)18(26-21)13-34-19(31)12-17(25-14(3)30)15-7-9-16(24)10-8-15/h7-10,17H,4-6,11-13H2,1-3H3,(H,25,30)(H,27,32,33) |
| InChIKey | UAQQXJPMPHHYKR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate?
The IUPAC name of (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate (CID 55402431) is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate.
What is the SMILES notation for (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate?
The canonical SMILES for (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate is CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)CC(NC(C)=O)c1ccc(Cl)cc1)n2CC.
What is the InChIKey of (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate?
The InChIKey is UAQQXJPMPHHYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClN5O5/c1-4-6-11-29-21-20(22(32)27-23(29)33)28(5-2)18(26-21)13-34-19(31)12-17(25-14(3)30)15-7-9-16(24)10-8-15/h7-10,17H,4-6,11-13H2,1-3H3,(H,25,30)(H,27,32,33).
What are the key properties of (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate?
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate has a molecular weight of 489.96 g/mol, XLogP of 2.67, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate is sourced from PubChem (CID 55402431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).