C30H40O8Si4 — CID 554029
6,7,16,17-tetrakis(trimethylsilyloxy)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4,6,8,14,16,18-octaene-2,12-dione (PubChem CID 554029) has the molecular formula C30H40O8Si4 and a molecular weight of 640.99 g/mol. Its IUPAC name is 6,7,16,17-tetrakis(trimethylsilyloxy)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4,6,8,14,16,18-octaene-2,12-dione.
| Compound Name | 6,7,16,17-tetrakis(trimethylsilyloxy)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4,6,8,14,16,18-octaene-2,12-dione |
|---|---|
| PubChem CID | 554029 |
| Molecular Formula | C30H40O8Si4 |
| Molecular Weight | 640.99 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | 6,7,16,17-tetrakis(trimethylsilyloxy)-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4,6,8,14,16,18-octaene-2,12-dione |
| SMILES | C[Si](C)(C)Oc1cc2oc3c(c2cc1O[Si](C)(C)C)C(=O)c1oc2cc(O[Si](C)(C)C)c(O[Si](C)(C)C)cc2c1C3=O |
| InChI | InChI=1S/C30H40O8Si4/c1-39(2,3)35-21-13-17-19(15-23(21)37-41(7,8)9)33-29-25(17)27(31)30-26(28(29)32)18-14-22(36-40(4,5)6)24(16-20(18)34-30)38-42(10,11)12/h13-16H,1-12H3 |
| InChIKey | WMJQNCOTNSSCLS-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.99 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|