C19H24N2O3S — CID 55402933
[2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate (PubChem CID 55402933) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 55402933 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)COC(=O)CCc1ccsc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-20(2)17-7-4-15(5-8-17)12-21(3)18(22)13-24-19(23)9-6-16-10-11-25-14-16/h4-5,7-8,10-11,14H,6,9,12-13H2,1-3H3 |
| InChIKey | VHGGIZZDJPQHSB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|