C23H26ClN3O4 — CID 55403327
[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-benzamidobutanoate (PubChem CID 55403327) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-benzamidobutanoate.
| Compound Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55403327 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCC(=O)N1CCN(c2cccc(Cl)c2)CC1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26ClN3O4/c1-17(25-23(30)18-6-3-2-4-7-18)14-22(29)31-16-21(28)27-12-10-26(11-13-27)20-9-5-8-19(24)15-20/h2-9,15,17H,10-14,16H2,1H3,(H,25,30) |
| InChIKey | XUSXIEFEJLREQZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |