C19H21FN2O6S2 — CID 55403436
1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-(4-methylsulfonylphenoxy)ethanone (PubChem CID 55403436) has the molecular formula C19H21FN2O6S2 and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-(4-methylsulfonylphenoxy)ethanone.
| Compound Name | 1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-(4-methylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 55403436 |
| Molecular Formula | C19H21FN2O6S2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-(4-methylsulfonylphenoxy)ethanone |
| SMILES | CS(=O)(=O)c1ccc(OCC(=O)N2CCN(S(=O)(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C19H21FN2O6S2/c1-29(24,25)16-8-6-15(7-9-16)28-14-19(23)21-10-12-22(13-11-21)30(26,27)18-5-3-2-4-17(18)20/h2-9H,10-14H2,1H3 |
| InChIKey | GPPRFLLQKFSFKX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |