C23H32N4O5S — CID 55404206
4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide (PubChem CID 55404206) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is 4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide.
| Compound Name | 4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 55404206 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
| SMILES | CCn1c(=O)c(=O)n(CC(=O)N2CCCC3CCCCC32)c2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C23H32N4O5S/c1-4-25-19-12-11-17(33(31,32)24(2)3)14-20(19)27(23(30)22(25)29)15-21(28)26-13-7-9-16-8-5-6-10-18(16)26/h11-12,14,16,18H,4-10,13,15H2,1-3H3 |
| InChIKey | ZJMXQRWWQSSMOS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|